stereochem. changes when reaction arrow is added

User b7aa615db3

20-10-2005 01:39:39

I'm trying to create a reaction whose reactant is O[C@H]1C=Cc2ccccc2[C@H]1O. I cannot create a reaction that is triggered by it (see the attached reaction). The stereo chemistry (R/S labels) change when I add the reaction arrow. I'm using MarvinSketch 4.0.1.

ChemAxon d76e6e95eb

20-10-2005 11:23:08

Seems a bug, thank you for reporting it! Will be corrected in Marvin 4.0.2.